C21H22ClN3O3 — CID 46407573
N'-(4-chlorobenzoyl)-1-(2-phenylacetyl)piperidine-3-carbohydrazide (PubChem CID 46407573) has the molecular formula C21H22ClN3O3 and a molecular weight of 399.88 g/mol. Its IUPAC name is N'-(4-chlorobenzoyl)-1-(2-phenylacetyl)piperidine-3-carbohydrazide.
| Compound Name | N'-(4-chlorobenzoyl)-1-(2-phenylacetyl)piperidine-3-carbohydrazide |
|---|---|
| PubChem CID | 46407573 |
| Molecular Formula | C21H22ClN3O3 |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | N'-(4-chlorobenzoyl)-1-(2-phenylacetyl)piperidine-3-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CCCN(C(=O)Cc2ccccc2)C1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H22ClN3O3/c22-18-10-8-16(9-11-18)20(27)23-24-21(28)17-7-4-12-25(14-17)19(26)13-15-5-2-1-3-6-15/h1-3,5-6,8-11,17H,4,7,12-14H2,(H,23,27)(H,24,28) |
| InChIKey | JXGCYEORCHTGOS-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|