C21H23NO2 — CID 110394612
1-[3-(4-methylbenzoyl)piperidin-1-yl]-2-phenylethanone (PubChem CID 110394612) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 1-[3-(4-methylbenzoyl)piperidin-1-yl]-2-phenylethanone.
| Compound Name | 1-[3-(4-methylbenzoyl)piperidin-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 110394612 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 1-[3-(4-methylbenzoyl)piperidin-1-yl]-2-phenylethanone |
| SMILES | Cc1ccc(C(=O)C2CCCN(C(=O)Cc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C21H23NO2/c1-16-9-11-18(12-10-16)21(24)19-8-5-13-22(15-19)20(23)14-17-6-3-2-4-7-17/h2-4,6-7,9-12,19H,5,8,13-15H2,1H3 |
| InChIKey | RLOJISKLSXDPOS-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |