C22H25NO2S — CID 42309527
3-methylsulfanyl-1-[(3S)-3-(4-phenylbenzoyl)piperidin-1-yl]propan-1-one (PubChem CID 42309527) has the molecular formula C22H25NO2S and a molecular weight of 367.51 g/mol. Its IUPAC name is 3-methylsulfanyl-1-[(3S)-3-(4-phenylbenzoyl)piperidin-1-yl]propan-1-one.
| Compound Name | 3-methylsulfanyl-1-[(3S)-3-(4-phenylbenzoyl)piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 42309527 |
| Molecular Formula | C22H25NO2S |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 3-methylsulfanyl-1-[(3S)-3-(4-phenylbenzoyl)piperidin-1-yl]propan-1-one |
| SMILES | CSCCC(=O)N1CCC[C@H](C(=O)c2ccc(-c3ccccc3)cc2)C1 |
| InChI | InChI=1S/C22H25NO2S/c1-26-15-13-21(24)23-14-5-8-20(16-23)22(25)19-11-9-18(10-12-19)17-6-3-2-4-7-17/h2-4,6-7,9-12,20H,5,8,13-16H2,1H3/t20-/m0/s1 |
| InChIKey | NTNRXYSYUGTQCX-FQEVSTJZSA-N |
| XLogP | 4.53 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |