C24H22N2O2 — CID 42356484
(4-phenylphenyl)-[(3R)-1-(pyridine-4-carbonyl)piperidin-3-yl]methanone (PubChem CID 42356484) has the molecular formula C24H22N2O2 and a molecular weight of 370.45 g/mol. Its IUPAC name is (4-phenylphenyl)-[(3R)-1-(pyridine-4-carbonyl)piperidin-3-yl]methanone.
| Compound Name | (4-phenylphenyl)-[(3R)-1-(pyridine-4-carbonyl)piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 42356484 |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | (4-phenylphenyl)-[(3R)-1-(pyridine-4-carbonyl)piperidin-3-yl]methanone |
| SMILES | O=C(c1ccc(-c2ccccc2)cc1)[C@@H]1CCCN(C(=O)c2ccncc2)C1 |
| InChI | InChI=1S/C24H22N2O2/c27-23(20-10-8-19(9-11-20)18-5-2-1-3-6-18)22-7-4-16-26(17-22)24(28)21-12-14-25-15-13-21/h1-3,5-6,8-15,22H,4,7,16-17H2/t22-/m1/s1 |
| InChIKey | GHLWTLFBRGZQOA-JOCHJYFZSA-N |
| XLogP | 4.48 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |