C22H21NO2 — CID 25485299
1-[(3R)-3-(4-phenylbenzoyl)piperidin-1-yl]but-2-yn-1-one (PubChem CID 25485299) has the molecular formula C22H21NO2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 1-[(3R)-3-(4-phenylbenzoyl)piperidin-1-yl]but-2-yn-1-one.
| Compound Name | 1-[(3R)-3-(4-phenylbenzoyl)piperidin-1-yl]but-2-yn-1-one |
|---|---|
| PubChem CID | 25485299 |
| Molecular Formula | C22H21NO2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 1-[(3R)-3-(4-phenylbenzoyl)piperidin-1-yl]but-2-yn-1-one |
| SMILES | CC#CC(=O)N1CCC[C@@H](C(=O)c2ccc(-c3ccccc3)cc2)C1 |
| InChI | InChI=1S/C22H21NO2/c1-2-7-21(24)23-15-6-10-20(16-23)22(25)19-13-11-18(12-14-19)17-8-4-3-5-9-17/h3-5,8-9,11-14,20H,6,10,15-16H2,1H3/t20-/m1/s1 |
| InChIKey | JZZIRLSQKQRNJB-HXUWFJFHSA-N |
| XLogP | 3.80 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|