C26H31N3O3 — CID 78861461
1-[3-(4-benzoyl-1,4-diazepane-1-carbonyl)piperidin-1-yl]-2-phenylethanone (PubChem CID 78861461) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is 1-[3-(4-benzoyl-1,4-diazepane-1-carbonyl)piperidin-1-yl]-2-phenylethanone.
| Compound Name | 1-[3-(4-benzoyl-1,4-diazepane-1-carbonyl)piperidin-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 78861461 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | 1-[3-(4-benzoyl-1,4-diazepane-1-carbonyl)piperidin-1-yl]-2-phenylethanone |
| SMILES | O=C(Cc1ccccc1)N1CCCC(C(=O)N2CCCN(C(=O)c3ccccc3)CC2)C1 |
| InChI | InChI=1S/C26H31N3O3/c30-24(19-21-9-3-1-4-10-21)29-14-7-13-23(20-29)26(32)28-16-8-15-27(17-18-28)25(31)22-11-5-2-6-12-22/h1-6,9-12,23H,7-8,13-20H2 |
| InChIKey | LJEGYLSFPSRBRL-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |