C25H28FN3O3 — CID 46546638
1-[3-[4-(4-fluorobenzoyl)piperazine-1-carbonyl]piperidin-1-yl]-2-phenylethanone (PubChem CID 46546638) has the molecular formula C25H28FN3O3 and a molecular weight of 437.52 g/mol. Its IUPAC name is 1-[3-[4-(4-fluorobenzoyl)piperazine-1-carbonyl]piperidin-1-yl]-2-phenylethanone.
| Compound Name | 1-[3-[4-(4-fluorobenzoyl)piperazine-1-carbonyl]piperidin-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 46546638 |
| Molecular Formula | C25H28FN3O3 |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 1-[3-[4-(4-fluorobenzoyl)piperazine-1-carbonyl]piperidin-1-yl]-2-phenylethanone |
| SMILES | O=C(Cc1ccccc1)N1CCCC(C(=O)N2CCN(C(=O)c3ccc(F)cc3)CC2)C1 |
| InChI | InChI=1S/C25H28FN3O3/c26-22-10-8-20(9-11-22)24(31)27-13-15-28(16-14-27)25(32)21-7-4-12-29(18-21)23(30)17-19-5-2-1-3-6-19/h1-3,5-6,8-11,21H,4,7,12-18H2 |
| InChIKey | BIOSUNBEIGYSBN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |