C25H35FN4O3 — CID 55466088
1-(azepan-1-yl)-2-[4-[1-(4-fluorobenzoyl)piperidine-3-carbonyl]piperazin-1-yl]ethanone (PubChem CID 55466088) has the molecular formula C25H35FN4O3 and a molecular weight of 458.58 g/mol. Its IUPAC name is 1-(azepan-1-yl)-2-[4-[1-(4-fluorobenzoyl)piperidine-3-carbonyl]piperazin-1-yl]ethanone.
| Compound Name | 1-(azepan-1-yl)-2-[4-[1-(4-fluorobenzoyl)piperidine-3-carbonyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 55466088 |
| Molecular Formula | C25H35FN4O3 |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | 1-(azepan-1-yl)-2-[4-[1-(4-fluorobenzoyl)piperidine-3-carbonyl]piperazin-1-yl]ethanone |
| SMILES | O=C(CN1CCN(C(=O)C2CCCN(C(=O)c3ccc(F)cc3)C2)CC1)N1CCCCCC1 |
| InChI | InChI=1S/C25H35FN4O3/c26-22-9-7-20(8-10-22)24(32)30-13-5-6-21(18-30)25(33)29-16-14-27(15-17-29)19-23(31)28-11-3-1-2-4-12-28/h7-10,21H,1-6,11-19H2 |
| InChIKey | NBIGIXIWDBKMMQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |