C18H24FN3O2 — CID 119372894
(4-aminopiperidin-1-yl)-[1-(4-fluorobenzoyl)piperidin-3-yl]methanone (PubChem CID 119372894) has the molecular formula C18H24FN3O2 and a molecular weight of 333.41 g/mol. Its IUPAC name is (4-aminopiperidin-1-yl)-[1-(4-fluorobenzoyl)piperidin-3-yl]methanone.
| Compound Name | (4-aminopiperidin-1-yl)-[1-(4-fluorobenzoyl)piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 119372894 |
| Molecular Formula | C18H24FN3O2 |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | (4-aminopiperidin-1-yl)-[1-(4-fluorobenzoyl)piperidin-3-yl]methanone |
| SMILES | NC1CCN(C(=O)C2CCCN(C(=O)c3ccc(F)cc3)C2)CC1 |
| InChI | InChI=1S/C18H24FN3O2/c19-15-5-3-13(4-6-15)17(23)22-9-1-2-14(12-22)18(24)21-10-7-16(20)8-11-21/h3-6,14,16H,1-2,7-12,20H2 |
| InChIKey | CUFVGQYWQVEVGR-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |