C13H16FN3O2 — CID 54793956
1-(4-fluorobenzoyl)piperidine-3-carbohydrazide (PubChem CID 54793956) has the molecular formula C13H16FN3O2 and a molecular weight of 265.29 g/mol. Its IUPAC name is 1-(4-fluorobenzoyl)piperidine-3-carbohydrazide.
| Compound Name | 1-(4-fluorobenzoyl)piperidine-3-carbohydrazide |
|---|---|
| PubChem CID | 54793956 |
| Molecular Formula | C13H16FN3O2 |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 1-(4-fluorobenzoyl)piperidine-3-carbohydrazide |
| SMILES | NNC(=O)C1CCCN(C(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C13H16FN3O2/c14-11-5-3-9(4-6-11)13(19)17-7-1-2-10(8-17)12(18)16-15/h3-6,10H,1-2,7-8,15H2,(H,16,18) |
| InChIKey | IJLOMWRAMLFULD-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|