C19H16F4N2O2 — CID 24534971
1-(4-fluorobenzoyl)-N-(2,3,4-trifluorophenyl)piperidine-3-carboxamide (PubChem CID 24534971) has the molecular formula C19H16F4N2O2 and a molecular weight of 380.34 g/mol. Its IUPAC name is 1-(4-fluorobenzoyl)-N-(2,3,4-trifluorophenyl)piperidine-3-carboxamide.
| Compound Name | 1-(4-fluorobenzoyl)-N-(2,3,4-trifluorophenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 24534971 |
| Molecular Formula | C19H16F4N2O2 |
| Molecular Weight | 380.34 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 1-(4-fluorobenzoyl)-N-(2,3,4-trifluorophenyl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)C1CCCN(C(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C19H16F4N2O2/c20-13-5-3-11(4-6-13)19(27)25-9-1-2-12(10-25)18(26)24-15-8-7-14(21)16(22)17(15)23/h3-8,12H,1-2,9-10H2,(H,24,26) |
| InChIKey | QWBRPUSVUUMQTC-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|