C25H22F3N3O3 — CID 16865946
1-(1-benzyl-6-oxopyridine-3-carbonyl)-N-(2,3,4-trifluorophenyl)piperidine-3-carboxamide (PubChem CID 16865946) has the molecular formula C25H22F3N3O3 and a molecular weight of 469.46 g/mol. Its IUPAC name is 1-(1-benzyl-6-oxopyridine-3-carbonyl)-N-(2,3,4-trifluorophenyl)piperidine-3-carboxamide.
| Compound Name | 1-(1-benzyl-6-oxopyridine-3-carbonyl)-N-(2,3,4-trifluorophenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 16865946 |
| Molecular Formula | C25H22F3N3O3 |
| Molecular Weight | 469.46 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | 1-(1-benzyl-6-oxopyridine-3-carbonyl)-N-(2,3,4-trifluorophenyl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)C1CCCN(C(=O)c2ccc(=O)n(Cc3ccccc3)c2)C1 |
| InChI | InChI=1S/C25H22F3N3O3/c26-19-9-10-20(23(28)22(19)27)29-24(33)17-7-4-12-30(14-17)25(34)18-8-11-21(32)31(15-18)13-16-5-2-1-3-6-16/h1-3,5-6,8-11,15,17H,4,7,12-14H2,(H,29,33) |
| InChIKey | ZVLDYFRQINEMJD-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|