C24H28FN3O2 — CID 25297530
(4-benzylpiperazin-1-yl)-[(3R)-1-(4-fluorobenzoyl)piperidin-3-yl]methanone (PubChem CID 25297530) has the molecular formula C24H28FN3O2 and a molecular weight of 409.51 g/mol. Its IUPAC name is (4-benzylpiperazin-1-yl)-[(3R)-1-(4-fluorobenzoyl)piperidin-3-yl]methanone.
| Compound Name | (4-benzylpiperazin-1-yl)-[(3R)-1-(4-fluorobenzoyl)piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 25297530 |
| Molecular Formula | C24H28FN3O2 |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | (4-benzylpiperazin-1-yl)-[(3R)-1-(4-fluorobenzoyl)piperidin-3-yl]methanone |
| SMILES | O=C(c1ccc(F)cc1)N1CCC[C@@H](C(=O)N2CCN(Cc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C24H28FN3O2/c25-22-10-8-20(9-11-22)23(29)28-12-4-7-21(18-28)24(30)27-15-13-26(14-16-27)17-19-5-2-1-3-6-19/h1-3,5-6,8-11,21H,4,7,12-18H2/t21-/m1/s1 |
| InChIKey | GWXSFROMZPPWBU-OAQYLSRUSA-N |
| XLogP | 3.02 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |