C26H32FN3O2 — CID 55454977
1-(4-fluorobenzoyl)-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]piperidine-3-carboxamide (PubChem CID 55454977) has the molecular formula C26H32FN3O2 and a molecular weight of 437.56 g/mol. Its IUPAC name is 1-(4-fluorobenzoyl)-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]piperidine-3-carboxamide.
| Compound Name | 1-(4-fluorobenzoyl)-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55454977 |
| Molecular Formula | C26H32FN3O2 |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | 1-(4-fluorobenzoyl)-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]piperidine-3-carboxamide |
| SMILES | O=C(NCc1ccc(CN2CCCCC2)cc1)C1CCCN(C(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C26H32FN3O2/c27-24-12-10-22(11-13-24)26(32)30-16-4-5-23(19-30)25(31)28-17-20-6-8-21(9-7-20)18-29-14-2-1-3-15-29/h6-13,23H,1-5,14-19H2,(H,28,31) |
| InChIKey | SPWIKWWTTSBPJI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |