C24H27FN4O3 — CID 46443168
1-(4-fluorobenzoyl)-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]piperidine-3-carboxamide (PubChem CID 46443168) has the molecular formula C24H27FN4O3 and a molecular weight of 438.50 g/mol. Its IUPAC name is 1-(4-fluorobenzoyl)-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]piperidine-3-carboxamide.
| Compound Name | 1-(4-fluorobenzoyl)-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 46443168 |
| Molecular Formula | C24H27FN4O3 |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 1-(4-fluorobenzoyl)-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]piperidine-3-carboxamide |
| SMILES | O=C1CN(c2ccc(CNC(=O)C3CCCN(C(=O)c4ccc(F)cc4)C3)cc2)CCN1 |
| InChI | InChI=1S/C24H27FN4O3/c25-20-7-5-18(6-8-20)24(32)29-12-1-2-19(15-29)23(31)27-14-17-3-9-21(10-4-17)28-13-11-26-22(30)16-28/h3-10,19H,1-2,11-16H2,(H,26,30)(H,27,31) |
| InChIKey | AHYFSVXLYNENPB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|