C24H27FN2O2 — CID 134799195
[1-(4-fluorobenzoyl)piperidin-3-yl]-(4-phenylpiperidin-1-yl)methanone (PubChem CID 134799195) has the molecular formula C24H27FN2O2 and a molecular weight of 394.49 g/mol. Its IUPAC name is [1-(4-fluorobenzoyl)piperidin-3-yl]-(4-phenylpiperidin-1-yl)methanone.
| Compound Name | [1-(4-fluorobenzoyl)piperidin-3-yl]-(4-phenylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 134799195 |
| Molecular Formula | C24H27FN2O2 |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | [1-(4-fluorobenzoyl)piperidin-3-yl]-(4-phenylpiperidin-1-yl)methanone |
| SMILES | O=C(c1ccc(F)cc1)N1CCCC(C(=O)N2CCC(c3ccccc3)CC2)C1 |
| InChI | InChI=1S/C24H27FN2O2/c25-22-10-8-20(9-11-22)23(28)27-14-4-7-21(17-27)24(29)26-15-12-19(13-16-26)18-5-2-1-3-6-18/h1-3,5-6,8-11,19,21H,4,7,12-17H2 |
| InChIKey | JKRIKOQMGSZCAQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |