C17H16F2N2O3 — CID 46569045
N-(2,4-difluorophenyl)-1-(furan-3-carbonyl)piperidine-3-carboxamide (PubChem CID 46569045) has the molecular formula C17H16F2N2O3 and a molecular weight of 334.32 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-1-(furan-3-carbonyl)piperidine-3-carboxamide.
| Compound Name | N-(2,4-difluorophenyl)-1-(furan-3-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 46569045 |
| Molecular Formula | C17H16F2N2O3 |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | N-(2,4-difluorophenyl)-1-(furan-3-carbonyl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1F)C1CCCN(C(=O)c2ccoc2)C1 |
| InChI | InChI=1S/C17H16F2N2O3/c18-13-3-4-15(14(19)8-13)20-16(22)11-2-1-6-21(9-11)17(23)12-5-7-24-10-12/h3-5,7-8,10-11H,1-2,6,9H2,(H,20,22) |
| InChIKey | NVCYBFBGNGWYMC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |