C17H16ClFN2O3 — CID 42948189
N-(3-chloro-4-fluorophenyl)-1-(furan-3-carbonyl)piperidine-3-carboxamide (PubChem CID 42948189) has the molecular formula C17H16ClFN2O3 and a molecular weight of 350.78 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-1-(furan-3-carbonyl)piperidine-3-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-1-(furan-3-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 42948189 |
| Molecular Formula | C17H16ClFN2O3 |
| Molecular Weight | 350.78 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-1-(furan-3-carbonyl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(Cl)c1)C1CCCN(C(=O)c2ccoc2)C1 |
| InChI | InChI=1S/C17H16ClFN2O3/c18-14-8-13(3-4-15(14)19)20-16(22)11-2-1-6-21(9-11)17(23)12-5-7-24-10-12/h3-5,7-8,10-11H,1-2,6,9H2,(H,20,22) |
| InChIKey | CBJBNGZRQJBATG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.78 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |