C17H22ClFN2O3 — CID 84555141
tert-butyl 3-[(3-chloro-4-fluorophenyl)carbamoyl]piperidine-1-carboxylate (PubChem CID 84555141) has the molecular formula C17H22ClFN2O3 and a molecular weight of 356.83 g/mol. Its IUPAC name is tert-butyl 3-[(3-chloro-4-fluorophenyl)carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(3-chloro-4-fluorophenyl)carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 84555141 |
| Molecular Formula | C17H22ClFN2O3 |
| Molecular Weight | 356.83 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | tert-butyl 3-[(3-chloro-4-fluorophenyl)carbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C(=O)Nc2ccc(F)c(Cl)c2)C1 |
| InChI | InChI=1S/C17H22ClFN2O3/c1-17(2,3)24-16(23)21-8-4-5-11(10-21)15(22)20-12-6-7-14(19)13(18)9-12/h6-7,9,11H,4-5,8,10H2,1-3H3,(H,20,22) |
| InChIKey | WZSCZGKRUFKULT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.83 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |