C22H33N3O6S — CID 24515330
tert-butyl 3-[(4-methyl-3-morpholin-4-ylsulfonylphenyl)carbamoyl]piperidine-1-carboxylate (PubChem CID 24515330) has the molecular formula C22H33N3O6S and a molecular weight of 467.59 g/mol. Its IUPAC name is tert-butyl 3-[(4-methyl-3-morpholin-4-ylsulfonylphenyl)carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(4-methyl-3-morpholin-4-ylsulfonylphenyl)carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 24515330 |
| Molecular Formula | C22H33N3O6S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | tert-butyl 3-[(4-methyl-3-morpholin-4-ylsulfonylphenyl)carbamoyl]piperidine-1-carboxylate |
| SMILES | Cc1ccc(NC(=O)C2CCCN(C(=O)OC(C)(C)C)C2)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C22H33N3O6S/c1-16-7-8-18(14-19(16)32(28,29)25-10-12-30-13-11-25)23-20(26)17-6-5-9-24(15-17)21(27)31-22(2,3)4/h7-8,14,17H,5-6,9-13,15H2,1-4H3,(H,23,26) |
| InChIKey | ZOEFYCRHQHACEW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |