C19H29N3O5S — CID 55960977
tert-butyl 3-[[4-(ethylsulfonylamino)phenyl]carbamoyl]piperidine-1-carboxylate (PubChem CID 55960977) has the molecular formula C19H29N3O5S and a molecular weight of 411.52 g/mol. Its IUPAC name is tert-butyl 3-[[4-(ethylsulfonylamino)phenyl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[4-(ethylsulfonylamino)phenyl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 55960977 |
| Molecular Formula | C19H29N3O5S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | tert-butyl 3-[[4-(ethylsulfonylamino)phenyl]carbamoyl]piperidine-1-carboxylate |
| SMILES | CCS(=O)(=O)Nc1ccc(NC(=O)C2CCCN(C(=O)OC(C)(C)C)C2)cc1 |
| InChI | InChI=1S/C19H29N3O5S/c1-5-28(25,26)21-16-10-8-15(9-11-16)20-17(23)14-7-6-12-22(13-14)18(24)27-19(2,3)4/h8-11,14,21H,5-7,12-13H2,1-4H3,(H,20,23) |
| InChIKey | IAMMNSIJMXMAHD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |