C21H32N2O4 — CID 84554251
tert-butyl 3-[(4-butoxyphenyl)carbamoyl]piperidine-1-carboxylate (PubChem CID 84554251) has the molecular formula C21H32N2O4 and a molecular weight of 376.50 g/mol. Its IUPAC name is tert-butyl 3-[(4-butoxyphenyl)carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(4-butoxyphenyl)carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 84554251 |
| Molecular Formula | C21H32N2O4 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | tert-butyl 3-[(4-butoxyphenyl)carbamoyl]piperidine-1-carboxylate |
| SMILES | CCCCOc1ccc(NC(=O)C2CCCN(C(=O)OC(C)(C)C)C2)cc1 |
| InChI | InChI=1S/C21H32N2O4/c1-5-6-14-26-18-11-9-17(10-12-18)22-19(24)16-8-7-13-23(15-16)20(25)27-21(2,3)4/h9-12,16H,5-8,13-15H2,1-4H3,(H,22,24) |
| InChIKey | PZAVUMRNWUBDMA-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|