C25H31N3O4 — CID 45280915
tert-butyl 3-[[4-(benzylcarbamoyl)phenyl]carbamoyl]piperidine-1-carboxylate (PubChem CID 45280915) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is tert-butyl 3-[[4-(benzylcarbamoyl)phenyl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[4-(benzylcarbamoyl)phenyl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 45280915 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | tert-butyl 3-[[4-(benzylcarbamoyl)phenyl]carbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C(=O)Nc2ccc(C(=O)NCc3ccccc3)cc2)C1 |
| InChI | InChI=1S/C25H31N3O4/c1-25(2,3)32-24(31)28-15-7-10-20(17-28)23(30)27-21-13-11-19(12-14-21)22(29)26-16-18-8-5-4-6-9-18/h4-6,8-9,11-14,20H,7,10,15-17H2,1-3H3,(H,26,29)(H,27,30) |
| InChIKey | OURJOCZTBZEHSC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |