C17H25N3O3 — CID 51253317
tert-butyl 3-(pyridin-4-ylmethylcarbamoyl)piperidine-1-carboxylate (PubChem CID 51253317) has the molecular formula C17H25N3O3 and a molecular weight of 319.40 g/mol. Its IUPAC name is tert-butyl 3-(pyridin-4-ylmethylcarbamoyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(pyridin-4-ylmethylcarbamoyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 51253317 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | tert-butyl 3-(pyridin-4-ylmethylcarbamoyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C(=O)NCc2ccncc2)C1 |
| InChI | InChI=1S/C17H25N3O3/c1-17(2,3)23-16(22)20-10-4-5-14(12-20)15(21)19-11-13-6-8-18-9-7-13/h6-9,14H,4-5,10-12H2,1-3H3,(H,19,21) |
| InChIKey | URBUCFZVEMNTGC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |