C18H24ClFN2O3 — CID 71630780
tert-butyl 3-[(2-chloro-6-fluorophenyl)methylcarbamoyl]piperidine-1-carboxylate (PubChem CID 71630780) has the molecular formula C18H24ClFN2O3 and a molecular weight of 370.85 g/mol. Its IUPAC name is tert-butyl 3-[(2-chloro-6-fluorophenyl)methylcarbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(2-chloro-6-fluorophenyl)methylcarbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71630780 |
| Molecular Formula | C18H24ClFN2O3 |
| Molecular Weight | 370.85 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | tert-butyl 3-[(2-chloro-6-fluorophenyl)methylcarbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C(=O)NCc2c(F)cccc2Cl)C1 |
| InChI | InChI=1S/C18H24ClFN2O3/c1-18(2,3)25-17(24)22-9-5-6-12(11-22)16(23)21-10-13-14(19)7-4-8-15(13)20/h4,7-8,12H,5-6,9-11H2,1-3H3,(H,21,23) |
| InChIKey | VSJLEGWHCOVUTJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.85 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |