C19H25N3O3 — CID 94044438
tert-butyl (3R)-3-[(4-cyanophenyl)methylcarbamoyl]piperidine-1-carboxylate (PubChem CID 94044438) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is tert-butyl (3R)-3-[(4-cyanophenyl)methylcarbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[(4-cyanophenyl)methylcarbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 94044438 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | tert-butyl (3R)-3-[(4-cyanophenyl)methylcarbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](C(=O)NCc2ccc(C#N)cc2)C1 |
| InChI | InChI=1S/C19H25N3O3/c1-19(2,3)25-18(24)22-10-4-5-16(13-22)17(23)21-12-15-8-6-14(11-20)7-9-15/h6-9,16H,4-5,10,12-13H2,1-3H3,(H,21,23)/t16-/m1/s1 |
| InChIKey | GQKANQWIUSRYIU-MRXNPFEDSA-N |
| XLogP | 2.82 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |