C15H17N3O3 — CID 62269126
1-[(4-cyanophenyl)methylcarbamoyl]piperidine-3-carboxylic acid (PubChem CID 62269126) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is 1-[(4-cyanophenyl)methylcarbamoyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[(4-cyanophenyl)methylcarbamoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 62269126 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 1-[(4-cyanophenyl)methylcarbamoyl]piperidine-3-carboxylic acid |
| SMILES | N#Cc1ccc(CNC(=O)N2CCCC(C(=O)O)C2)cc1 |
| InChI | InChI=1S/C15H17N3O3/c16-8-11-3-5-12(6-4-11)9-17-15(21)18-7-1-2-13(10-18)14(19)20/h3-6,13H,1-2,7,9-10H2,(H,17,21)(H,19,20) |
| InChIKey | IPLYKTKZCBKAHG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |