C16H20N4O3 — CID 95637606
methyl (3S)-3-[(4-cyanophenyl)methylcarbamoylamino]piperidine-1-carboxylate (PubChem CID 95637606) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is methyl (3S)-3-[(4-cyanophenyl)methylcarbamoylamino]piperidine-1-carboxylate.
| Compound Name | methyl (3S)-3-[(4-cyanophenyl)methylcarbamoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 95637606 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | methyl (3S)-3-[(4-cyanophenyl)methylcarbamoylamino]piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCC[C@H](NC(=O)NCc2ccc(C#N)cc2)C1 |
| InChI | InChI=1S/C16H20N4O3/c1-23-16(22)20-8-2-3-14(11-20)19-15(21)18-10-13-6-4-12(9-17)5-7-13/h4-7,14H,2-3,8,10-11H2,1H3,(H2,18,19,21)/t14-/m0/s1 |
| InChIKey | KFGMNBPVZKTXCE-AWEZNQCLSA-N |
| XLogP | 1.59 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |