C16H21N3O2 — CID 111504585
1-[(4-cyanophenyl)methyl]-3-[2-(hydroxymethyl)-2-methylcyclopentyl]urea (PubChem CID 111504585) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 1-[(4-cyanophenyl)methyl]-3-[2-(hydroxymethyl)-2-methylcyclopentyl]urea.
| Compound Name | 1-[(4-cyanophenyl)methyl]-3-[2-(hydroxymethyl)-2-methylcyclopentyl]urea |
|---|---|
| PubChem CID | 111504585 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 1-[(4-cyanophenyl)methyl]-3-[2-(hydroxymethyl)-2-methylcyclopentyl]urea |
| SMILES | CC1(CO)CCCC1NC(=O)NCc1ccc(C#N)cc1 |
| InChI | InChI=1S/C16H21N3O2/c1-16(11-20)8-2-3-14(16)19-15(21)18-10-13-6-4-12(9-17)5-7-13/h4-7,14,20H,2-3,8,10-11H2,1H3,(H2,18,19,21) |
| InChIKey | MFKVJLCOZKJWFO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |