C16H21F3N2O2 — CID 111504256
1-[2-(hydroxymethyl)-2-methylcyclopentyl]-3-[[4-(trifluoromethyl)phenyl]methyl]urea (PubChem CID 111504256) has the molecular formula C16H21F3N2O2 and a molecular weight of 330.35 g/mol. Its IUPAC name is 1-[2-(hydroxymethyl)-2-methylcyclopentyl]-3-[[4-(trifluoromethyl)phenyl]methyl]urea.
| Compound Name | 1-[2-(hydroxymethyl)-2-methylcyclopentyl]-3-[[4-(trifluoromethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 111504256 |
| Molecular Formula | C16H21F3N2O2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 1-[2-(hydroxymethyl)-2-methylcyclopentyl]-3-[[4-(trifluoromethyl)phenyl]methyl]urea |
| SMILES | CC1(CO)CCCC1NC(=O)NCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H21F3N2O2/c1-15(10-22)8-2-3-13(15)21-14(23)20-9-11-4-6-12(7-5-11)16(17,18)19/h4-7,13,22H,2-3,8-10H2,1H3,(H2,20,21,23) |
| InChIKey | MCIGNIFZWREIRF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |