C13H23F3N2O3 — CID 111504669
1-[2-(hydroxymethyl)-2-methylcyclopentyl]-3-[3-(2,2,2-trifluoroethoxy)propyl]urea (PubChem CID 111504669) has the molecular formula C13H23F3N2O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is 1-[2-(hydroxymethyl)-2-methylcyclopentyl]-3-[3-(2,2,2-trifluoroethoxy)propyl]urea.
| Compound Name | 1-[2-(hydroxymethyl)-2-methylcyclopentyl]-3-[3-(2,2,2-trifluoroethoxy)propyl]urea |
|---|---|
| PubChem CID | 111504669 |
| Molecular Formula | C13H23F3N2O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 1-[2-(hydroxymethyl)-2-methylcyclopentyl]-3-[3-(2,2,2-trifluoroethoxy)propyl]urea |
| SMILES | CC1(CO)CCCC1NC(=O)NCCCOCC(F)(F)F |
| InChI | InChI=1S/C13H23F3N2O3/c1-12(8-19)5-2-4-10(12)18-11(20)17-6-3-7-21-9-13(14,15)16/h10,19H,2-9H2,1H3,(H2,17,18,20) |
| InChIKey | UDHAELFNZLHDIM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|