C15H25F3N2O2 — CID 111504406
1-[2-(hydroxymethyl)-2-methylcyclopentyl]-3-[4-(trifluoromethyl)cyclohexyl]urea (PubChem CID 111504406) has the molecular formula C15H25F3N2O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is 1-[2-(hydroxymethyl)-2-methylcyclopentyl]-3-[4-(trifluoromethyl)cyclohexyl]urea.
| Compound Name | 1-[2-(hydroxymethyl)-2-methylcyclopentyl]-3-[4-(trifluoromethyl)cyclohexyl]urea |
|---|---|
| PubChem CID | 111504406 |
| Molecular Formula | C15H25F3N2O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 1-[2-(hydroxymethyl)-2-methylcyclopentyl]-3-[4-(trifluoromethyl)cyclohexyl]urea |
| SMILES | CC1(CO)CCCC1NC(=O)NC1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H25F3N2O2/c1-14(9-21)8-2-3-12(14)20-13(22)19-11-6-4-10(5-7-11)15(16,17)18/h10-12,21H,2-9H2,1H3,(H2,19,20,22) |
| InChIKey | AAYBXUVIJODQRR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |