C16H22F2N2O3 — CID 111506035
1-[2-(2,4-difluorophenoxy)ethyl]-3-[2-(hydroxymethyl)-2-methylcyclopentyl]urea (PubChem CID 111506035) has the molecular formula C16H22F2N2O3 and a molecular weight of 328.36 g/mol. Its IUPAC name is 1-[2-(2,4-difluorophenoxy)ethyl]-3-[2-(hydroxymethyl)-2-methylcyclopentyl]urea.
| Compound Name | 1-[2-(2,4-difluorophenoxy)ethyl]-3-[2-(hydroxymethyl)-2-methylcyclopentyl]urea |
|---|---|
| PubChem CID | 111506035 |
| Molecular Formula | C16H22F2N2O3 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 1-[2-(2,4-difluorophenoxy)ethyl]-3-[2-(hydroxymethyl)-2-methylcyclopentyl]urea |
| SMILES | CC1(CO)CCCC1NC(=O)NCCOc1ccc(F)cc1F |
| InChI | InChI=1S/C16H22F2N2O3/c1-16(10-21)6-2-3-14(16)20-15(22)19-7-8-23-13-5-4-11(17)9-12(13)18/h4-5,9,14,21H,2-3,6-8,10H2,1H3,(H2,19,20,22) |
| InChIKey | WLSSKTSOLMDSTQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|