C13H15F2NO3 — CID 113102317
N-[2-(2,4-difluorophenoxy)ethyl]oxolane-2-carboxamide (PubChem CID 113102317) has the molecular formula C13H15F2NO3 and a molecular weight of 271.26 g/mol. Its IUPAC name is N-[2-(2,4-difluorophenoxy)ethyl]oxolane-2-carboxamide.
| Compound Name | N-[2-(2,4-difluorophenoxy)ethyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 113102317 |
| Molecular Formula | C13H15F2NO3 |
| Molecular Weight | 271.26 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | N-[2-(2,4-difluorophenoxy)ethyl]oxolane-2-carboxamide |
| SMILES | O=C(NCCOc1ccc(F)cc1F)C1CCCO1 |
| InChI | InChI=1S/C13H15F2NO3/c14-9-3-4-11(10(15)8-9)19-7-5-16-13(17)12-2-1-6-18-12/h3-4,8,12H,1-2,5-7H2,(H,16,17) |
| InChIKey | KKWWJSGDFRVTKR-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.26 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|