C19H21F2NO2 — CID 113102340
4-tert-butyl-N-[2-(2,4-difluorophenoxy)ethyl]benzamide (PubChem CID 113102340) has the molecular formula C19H21F2NO2 and a molecular weight of 333.38 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-(2,4-difluorophenoxy)ethyl]benzamide.
| Compound Name | 4-tert-butyl-N-[2-(2,4-difluorophenoxy)ethyl]benzamide |
|---|---|
| PubChem CID | 113102340 |
| Molecular Formula | C19H21F2NO2 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 4-tert-butyl-N-[2-(2,4-difluorophenoxy)ethyl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)NCCOc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C19H21F2NO2/c1-19(2,3)14-6-4-13(5-7-14)18(23)22-10-11-24-17-9-8-15(20)12-16(17)21/h4-9,12H,10-11H2,1-3H3,(H,22,23) |
| InChIKey | RSMBFWWKIVQGRK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|