C16H24F2N2O3 — CID 111480845
1-[2-(2,4-difluorophenoxy)ethyl]-3-(4-hydroxy-2,2-dimethylpentyl)urea (PubChem CID 111480845) has the molecular formula C16H24F2N2O3 and a molecular weight of 330.38 g/mol. Its IUPAC name is 1-[2-(2,4-difluorophenoxy)ethyl]-3-(4-hydroxy-2,2-dimethylpentyl)urea.
| Compound Name | 1-[2-(2,4-difluorophenoxy)ethyl]-3-(4-hydroxy-2,2-dimethylpentyl)urea |
|---|---|
| PubChem CID | 111480845 |
| Molecular Formula | C16H24F2N2O3 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 1-[2-(2,4-difluorophenoxy)ethyl]-3-(4-hydroxy-2,2-dimethylpentyl)urea |
| SMILES | CC(O)CC(C)(C)CNC(=O)NCCOc1ccc(F)cc1F |
| InChI | InChI=1S/C16H24F2N2O3/c1-11(21)9-16(2,3)10-20-15(22)19-6-7-23-14-5-4-12(17)8-13(14)18/h4-5,8,11,21H,6-7,9-10H2,1-3H3,(H2,19,20,22) |
| InChIKey | BAHKXVDIOVBFSA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|