C13H18F2N2O3 — CID 94197746
1-[(2R)-1-(2,4-difluorophenoxy)propan-2-yl]-3-(2-methoxyethyl)urea (PubChem CID 94197746) has the molecular formula C13H18F2N2O3 and a molecular weight of 288.29 g/mol. Its IUPAC name is 1-[(2R)-1-(2,4-difluorophenoxy)propan-2-yl]-3-(2-methoxyethyl)urea.
| Compound Name | 1-[(2R)-1-(2,4-difluorophenoxy)propan-2-yl]-3-(2-methoxyethyl)urea |
|---|---|
| PubChem CID | 94197746 |
| Molecular Formula | C13H18F2N2O3 |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 1-[(2R)-1-(2,4-difluorophenoxy)propan-2-yl]-3-(2-methoxyethyl)urea |
| SMILES | COCCNC(=O)N[C@H](C)COc1ccc(F)cc1F |
| InChI | InChI=1S/C13H18F2N2O3/c1-9(17-13(18)16-5-6-19-2)8-20-12-4-3-10(14)7-11(12)15/h3-4,7,9H,5-6,8H2,1-2H3,(H2,16,17,18)/t9-/m1/s1 |
| InChIKey | KMTJAQJKDZPATR-SECBINFHSA-N |
| XLogP | 1.68 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|