C14H21ClF2N2O3 — CID 119742775
N-[1-(2,4-difluorophenoxy)propan-2-yl]-2-(2-methoxyethylamino)acetamide;hydrochloride (PubChem CID 119742775) has the molecular formula C14H21ClF2N2O3 and a molecular weight of 338.78 g/mol. Its IUPAC name is N-[1-(2,4-difluorophenoxy)propan-2-yl]-2-(2-methoxyethylamino)acetamide;hydrochloride.
| Compound Name | N-[1-(2,4-difluorophenoxy)propan-2-yl]-2-(2-methoxyethylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119742775 |
| Molecular Formula | C14H21ClF2N2O3 |
| Molecular Weight | 338.78 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | N-[1-(2,4-difluorophenoxy)propan-2-yl]-2-(2-methoxyethylamino)acetamide;hydrochloride |
| SMILES | COCCNCC(=O)NC(C)COc1ccc(F)cc1F.Cl |
| InChI | InChI=1S/C14H20F2N2O3.ClH/c1-10(18-14(19)8-17-5-6-20-2)9-21-13-4-3-11(15)7-12(13)16;/h3-4,7,10,17H,5-6,8-9H2,1-2H3,(H,18,19);1H |
| InChIKey | WBFHNEOKCOJJEY-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.78 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|