C18H20F2N2O5 — CID 112976270
1-[2-(2,4-difluorophenoxy)ethyl]-3-(3,4,5-trimethoxyphenyl)urea (PubChem CID 112976270) has the molecular formula C18H20F2N2O5 and a molecular weight of 382.36 g/mol. Its IUPAC name is 1-[2-(2,4-difluorophenoxy)ethyl]-3-(3,4,5-trimethoxyphenyl)urea.
| Compound Name | 1-[2-(2,4-difluorophenoxy)ethyl]-3-(3,4,5-trimethoxyphenyl)urea |
|---|---|
| PubChem CID | 112976270 |
| Molecular Formula | C18H20F2N2O5 |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 1-[2-(2,4-difluorophenoxy)ethyl]-3-(3,4,5-trimethoxyphenyl)urea |
| SMILES | COc1cc(NC(=O)NCCOc2ccc(F)cc2F)cc(OC)c1OC |
| InChI | InChI=1S/C18H20F2N2O5/c1-24-15-9-12(10-16(25-2)17(15)26-3)22-18(23)21-6-7-27-14-5-4-11(19)8-13(14)20/h4-5,8-10H,6-7H2,1-3H3,(H2,21,22,23) |
| InChIKey | QOPWNPVLPUNNJR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|