C16H15F2NO3 — CID 113102332
N-[2-(2,4-difluorophenoxy)ethyl]-2-methoxybenzamide (PubChem CID 113102332) has the molecular formula C16H15F2NO3 and a molecular weight of 307.30 g/mol. Its IUPAC name is N-[2-(2,4-difluorophenoxy)ethyl]-2-methoxybenzamide.
| Compound Name | N-[2-(2,4-difluorophenoxy)ethyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 113102332 |
| Molecular Formula | C16H15F2NO3 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | N-[2-(2,4-difluorophenoxy)ethyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)NCCOc1ccc(F)cc1F |
| InChI | InChI=1S/C16H15F2NO3/c1-21-14-5-3-2-4-12(14)16(20)19-8-9-22-15-7-6-11(17)10-13(15)18/h2-7,10H,8-9H2,1H3,(H,19,20) |
| InChIKey | CYWOZFRAKUNOAR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|