C16H16F2N2O4 — CID 46859657
1-(2,4-difluorophenyl)-3-(3,4,5-trimethoxyphenyl)urea (PubChem CID 46859657) has the molecular formula C16H16F2N2O4 and a molecular weight of 338.31 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-(3,4,5-trimethoxyphenyl)urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-(3,4,5-trimethoxyphenyl)urea |
|---|---|
| PubChem CID | 46859657 |
| Molecular Formula | C16H16F2N2O4 |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-(3,4,5-trimethoxyphenyl)urea |
| SMILES | COc1cc(NC(=O)Nc2ccc(F)cc2F)cc(OC)c1OC |
| InChI | InChI=1S/C16H16F2N2O4/c1-22-13-7-10(8-14(23-2)15(13)24-3)19-16(21)20-12-5-4-9(17)6-11(12)18/h4-8H,1-3H3,(H2,19,20,21) |
| InChIKey | ASPMELKOVRWUER-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |