C17H18F2N2O4 — CID 51579250
1-(2,4-difluorophenyl)-3-[(3,4,5-trimethoxyphenyl)methyl]urea (PubChem CID 51579250) has the molecular formula C17H18F2N2O4 and a molecular weight of 352.34 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[(3,4,5-trimethoxyphenyl)methyl]urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[(3,4,5-trimethoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 51579250 |
| Molecular Formula | C17H18F2N2O4 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[(3,4,5-trimethoxyphenyl)methyl]urea |
| SMILES | COc1cc(CNC(=O)Nc2ccc(F)cc2F)cc(OC)c1OC |
| InChI | InChI=1S/C17H18F2N2O4/c1-23-14-6-10(7-15(24-2)16(14)25-3)9-20-17(22)21-13-5-4-11(18)8-12(13)19/h4-8H,9H2,1-3H3,(H2,20,21,22) |
| InChIKey | HKRCFFAMJQALFF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |