C18H22N2O5 — CID 3774763
1-(3-methoxyphenyl)-3-[(3,4,5-trimethoxyphenyl)methyl]urea (PubChem CID 3774763) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-3-[(3,4,5-trimethoxyphenyl)methyl]urea.
| Compound Name | 1-(3-methoxyphenyl)-3-[(3,4,5-trimethoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 3774763 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 1-(3-methoxyphenyl)-3-[(3,4,5-trimethoxyphenyl)methyl]urea |
| SMILES | COc1cccc(NC(=O)NCc2cc(OC)c(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C18H22N2O5/c1-22-14-7-5-6-13(10-14)20-18(21)19-11-12-8-15(23-2)17(25-4)16(9-12)24-3/h5-10H,11H2,1-4H3,(H2,19,20,21) |
| InChIKey | CTLXHLGIMQQHQN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |