C18H19F3N2O4 — CID 38268450
1-[(3,4-dimethoxyphenyl)methyl]-3-[3-(2,2,2-trifluoroethoxy)phenyl]urea (PubChem CID 38268450) has the molecular formula C18H19F3N2O4 and a molecular weight of 384.35 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-3-[3-(2,2,2-trifluoroethoxy)phenyl]urea.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-[3-(2,2,2-trifluoroethoxy)phenyl]urea |
|---|---|
| PubChem CID | 38268450 |
| Molecular Formula | C18H19F3N2O4 |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-[3-(2,2,2-trifluoroethoxy)phenyl]urea |
| SMILES | COc1ccc(CNC(=O)Nc2cccc(OCC(F)(F)F)c2)cc1OC |
| InChI | InChI=1S/C18H19F3N2O4/c1-25-15-7-6-12(8-16(15)26-2)10-22-17(24)23-13-4-3-5-14(9-13)27-11-18(19,20)21/h3-9H,10-11H2,1-2H3,(H2,22,23,24) |
| InChIKey | KSMHHFHMVRTPBV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |