C19H21F3N2O4 — CID 86841804
1-[2-(2-methoxyethoxy)phenyl]-3-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]urea (PubChem CID 86841804) has the molecular formula C19H21F3N2O4 and a molecular weight of 398.38 g/mol. Its IUPAC name is 1-[2-(2-methoxyethoxy)phenyl]-3-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]urea.
| Compound Name | 1-[2-(2-methoxyethoxy)phenyl]-3-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]urea |
|---|---|
| PubChem CID | 86841804 |
| Molecular Formula | C19H21F3N2O4 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 1-[2-(2-methoxyethoxy)phenyl]-3-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]urea |
| SMILES | COCCOc1ccccc1NC(=O)NCc1cccc(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C19H21F3N2O4/c1-26-9-10-27-17-8-3-2-7-16(17)24-18(25)23-12-14-5-4-6-15(11-14)28-13-19(20,21)22/h2-8,11H,9-10,12-13H2,1H3,(H2,23,24,25) |
| InChIKey | ULOOAMDBLFAJRZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|