C14H18F3NO3 — CID 58686888
tert-butyl N-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamate (PubChem CID 58686888) has the molecular formula C14H18F3NO3 and a molecular weight of 305.30 g/mol. Its IUPAC name is tert-butyl N-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 58686888 |
| Molecular Formula | C14H18F3NO3 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | tert-butyl N-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cccc(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C14H18F3NO3/c1-13(2,3)21-12(19)18-8-10-5-4-6-11(7-10)20-9-14(15,16)17/h4-7H,8-9H2,1-3H3,(H,18,19) |
| InChIKey | UWABMQNPAYLFOK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |