C14H17F6N3O — CID 109471043
2-methyl-1-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109471043) has the molecular formula C14H17F6N3O and a molecular weight of 357.30 g/mol. Its IUPAC name is 2-methyl-1-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 2-methyl-1-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109471043 |
| Molecular Formula | C14H17F6N3O |
| Molecular Weight | 357.30 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 2-methyl-1-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | C/N=C(\NCCC(F)(F)F)NCc1cccc(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C14H17F6N3O/c1-21-12(22-6-5-13(15,16)17)23-8-10-3-2-4-11(7-10)24-9-14(18,19)20/h2-4,7H,5-6,8-9H2,1H3,(H2,21,22,23) |
| InChIKey | HRNGTUGJWKMFGM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.30 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|