C15H23F3IN3O — CID 109471948
2-methyl-1-[(3-propoxyphenyl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109471948) has the molecular formula C15H23F3IN3O and a molecular weight of 445.27 g/mol. Its IUPAC name is 2-methyl-1-[(3-propoxyphenyl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(3-propoxyphenyl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109471948 |
| Molecular Formula | C15H23F3IN3O |
| Molecular Weight | 445.27 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | 2-methyl-1-[(3-propoxyphenyl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | CCCOc1cccc(CN/C(=N/C)NCCC(F)(F)F)c1.I |
| InChI | InChI=1S/C15H22F3N3O.HI/c1-3-9-22-13-6-4-5-12(10-13)11-21-14(19-2)20-8-7-15(16,17)18;/h4-6,10H,3,7-9,11H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | LISYEXDEYXCJQU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.27 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|