C20H31F3N4O2 — CID 109474015
2-methyl-1-[[3-[2-[methyl(oxan-4-yl)amino]ethoxy]phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109474015) has the molecular formula C20H31F3N4O2 and a molecular weight of 416.49 g/mol. Its IUPAC name is 2-methyl-1-[[3-[2-[methyl(oxan-4-yl)amino]ethoxy]phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 2-methyl-1-[[3-[2-[methyl(oxan-4-yl)amino]ethoxy]phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109474015 |
| Molecular Formula | C20H31F3N4O2 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | 2-methyl-1-[[3-[2-[methyl(oxan-4-yl)amino]ethoxy]phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | C/N=C(\NCCC(F)(F)F)NCc1cccc(OCCN(C)C2CCOCC2)c1 |
| InChI | InChI=1S/C20H31F3N4O2/c1-24-19(25-9-8-20(21,22)23)26-15-16-4-3-5-18(14-16)29-13-10-27(2)17-6-11-28-12-7-17/h3-5,14,17H,6-13,15H2,1-2H3,(H2,24,25,26) |
| InChIKey | DBLXOPAWMOKSIV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|