C16H24F3N3O — CID 109472789
1-[(3-butoxyphenyl)methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109472789) has the molecular formula C16H24F3N3O and a molecular weight of 331.38 g/mol. Its IUPAC name is 1-[(3-butoxyphenyl)methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 1-[(3-butoxyphenyl)methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109472789 |
| Molecular Formula | C16H24F3N3O |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 1-[(3-butoxyphenyl)methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | CCCCOc1cccc(CN/C(=N/C)NCCC(F)(F)F)c1 |
| InChI | InChI=1S/C16H24F3N3O/c1-3-4-10-23-14-7-5-6-13(11-14)12-22-15(20-2)21-9-8-16(17,18)19/h5-7,11H,3-4,8-10,12H2,1-2H3,(H2,20,21,22) |
| InChIKey | XMFFORWOYNHVSE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|